C9H8ClNO3S — CID 131279795
5-ethyl-1,3-benzoxazole-2-sulfonyl chloride (PubChem CID 131279795) has the molecular formula C9H8ClNO3S and a molecular weight of 245.69 g/mol. Its IUPAC name is 5-ethyl-1,3-benzoxazole-2-sulfonyl chloride.
| Compound Name | 5-ethyl-1,3-benzoxazole-2-sulfonyl chloride |
|---|---|
| PubChem CID | 131279795 |
| Molecular Formula | C9H8ClNO3S |
| Molecular Weight | 245.69 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | 5-ethyl-1,3-benzoxazole-2-sulfonyl chloride |
| SMILES | CCc1ccc2oc(S(=O)(=O)Cl)nc2c1 |
| InChI | InChI=1S/C9H8ClNO3S/c1-2-6-3-4-8-7(5-6)11-9(14-8)15(10,12)13/h3-5H,2H2,1H3 |
| InChIKey | XEHJHKAUXDLRGI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.69 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |