C11H10NO3- — CID 6986797
2-(2-ethyl-1,3-benzoxazol-5-yl)acetate (PubChem CID 6986797) has the molecular formula C11H10NO3- and a molecular weight of 204.20 g/mol. Its IUPAC name is 2-(2-ethyl-1,3-benzoxazol-5-yl)acetate.
| Compound Name | 2-(2-ethyl-1,3-benzoxazol-5-yl)acetate |
|---|---|
| PubChem CID | 6986797 |
| Molecular Formula | C11H10NO3- |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 2-(2-ethyl-1,3-benzoxazol-5-yl)acetate |
| SMILES | CCc1nc2cc(CC(=O)[O-])ccc2o1 |
| InChI | InChI=1S/C11H11NO3/c1-2-10-12-8-5-7(6-11(13)14)3-4-9(8)15-10/h3-5H,2,6H2,1H3,(H,13,14)/p-1 |
| InChIKey | HVDCPJSFTRJARN-UHFFFAOYSA-M |
| XLogP | 0.68 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |