C14H11N3O5 — CID 60556890
N-(2-ethyl-1,3-benzoxazol-5-yl)-5-nitrofuran-2-carboxamide (PubChem CID 60556890) has the molecular formula C14H11N3O5 and a molecular weight of 301.26 g/mol. Its IUPAC name is N-(2-ethyl-1,3-benzoxazol-5-yl)-5-nitrofuran-2-carboxamide.
| Compound Name | N-(2-ethyl-1,3-benzoxazol-5-yl)-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 60556890 |
| Molecular Formula | C14H11N3O5 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | N-(2-ethyl-1,3-benzoxazol-5-yl)-5-nitrofuran-2-carboxamide |
| SMILES | CCc1nc2cc(NC(=O)c3ccc([N+](=O)[O-])o3)ccc2o1 |
| InChI | InChI=1S/C14H11N3O5/c1-2-12-16-9-7-8(3-4-10(9)21-12)15-14(18)11-5-6-13(22-11)17(19)20/h3-7H,2H2,1H3,(H,15,18) |
| InChIKey | ZJMKKVPRMNLILD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|