C12H8N4O5 — CID 4643764
5-nitro-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)furan-2-carboxamide (PubChem CID 4643764) has the molecular formula C12H8N4O5 and a molecular weight of 288.22 g/mol. Its IUPAC name is 5-nitro-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)furan-2-carboxamide.
| Compound Name | 5-nitro-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 4643764 |
| Molecular Formula | C12H8N4O5 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 5-nitro-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C12H8N4O5/c17-11(9-3-4-10(21-9)16(19)20)13-6-1-2-7-8(5-6)15-12(18)14-7/h1-5H,(H,13,17)(H2,14,15,18) |
| InChIKey | UECSQGPEBVKMMB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 134.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|