C16H10N4O5 — CID 60557174
N-[2-(furan-2-yl)-3H-benzimidazol-5-yl]-5-nitrofuran-2-carboxamide (PubChem CID 60557174) has the molecular formula C16H10N4O5 and a molecular weight of 338.28 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-3H-benzimidazol-5-yl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[2-(furan-2-yl)-3H-benzimidazol-5-yl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 60557174 |
| Molecular Formula | C16H10N4O5 |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | N-[2-(furan-2-yl)-3H-benzimidazol-5-yl]-5-nitrofuran-2-carboxamide |
| SMILES | O=C(Nc1ccc2nc(-c3ccco3)[nH]c2c1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C16H10N4O5/c21-16(13-5-6-14(25-13)20(22)23)17-9-3-4-10-11(8-9)19-15(18-10)12-2-1-7-24-12/h1-8H,(H,17,21)(H,18,19) |
| InChIKey | NXZBEWMPLRYRQO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|