C22H22N4O4S — CID 60526245
3-(diethylsulfamoyl)-N-[2-(furan-2-yl)-3H-benzimidazol-5-yl]benzamide (PubChem CID 60526245) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-[2-(furan-2-yl)-3H-benzimidazol-5-yl]benzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-[2-(furan-2-yl)-3H-benzimidazol-5-yl]benzamide |
|---|---|
| PubChem CID | 60526245 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-[2-(furan-2-yl)-3H-benzimidazol-5-yl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)Nc2ccc3nc(-c4ccco4)[nH]c3c2)c1 |
| InChI | InChI=1S/C22H22N4O4S/c1-3-26(4-2)31(28,29)17-8-5-7-15(13-17)22(27)23-16-10-11-18-19(14-16)25-21(24-18)20-9-6-12-30-20/h5-14H,3-4H2,1-2H3,(H,23,27)(H,24,25) |
| InChIKey | VCTKUWLGMLNCKY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |