C22H19N3O3S — CID 7522685
N-[3-(1H-benzimidazol-2-yl)phenyl]-3-ethylsulfonylbenzamide (PubChem CID 7522685) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)phenyl]-3-ethylsulfonylbenzamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)phenyl]-3-ethylsulfonylbenzamide |
|---|---|
| PubChem CID | 7522685 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)phenyl]-3-ethylsulfonylbenzamide |
| SMILES | CCS(=O)(=O)c1cccc(C(=O)Nc2cccc(-c3nc4ccccc4[nH]3)c2)c1 |
| InChI | InChI=1S/C22H19N3O3S/c1-2-29(27,28)18-10-6-8-16(14-18)22(26)23-17-9-5-7-15(13-17)21-24-19-11-3-4-12-20(19)25-21/h3-14H,2H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | FGGBBEVRYGXKQK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |