C23H16N4O3S — CID 55863771
N-[4-[[2-(furan-2-yl)-3H-benzimidazol-5-yl]carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 55863771) has the molecular formula C23H16N4O3S and a molecular weight of 428.47 g/mol. Its IUPAC name is N-[4-[[2-(furan-2-yl)-3H-benzimidazol-5-yl]carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[[2-(furan-2-yl)-3H-benzimidazol-5-yl]carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55863771 |
| Molecular Formula | C23H16N4O3S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | N-[4-[[2-(furan-2-yl)-3H-benzimidazol-5-yl]carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc2nc(-c3ccco3)[nH]c2c1)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C23H16N4O3S/c28-22(14-5-7-15(8-6-14)24-23(29)20-4-2-12-31-20)25-16-9-10-17-18(13-16)27-21(26-17)19-3-1-11-30-19/h1-13H,(H,24,29)(H,25,28)(H,26,27) |
| InChIKey | RJTCCUQYMGVUBM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |