C23H16N4O2S2 — CID 20695064
N-[4-[6-(thiophene-3-carbonylamino)-1H-benzimidazol-2-yl]phenyl]thiophene-2-carboxamide (PubChem CID 20695064) has the molecular formula C23H16N4O2S2 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-[4-[6-(thiophene-3-carbonylamino)-1H-benzimidazol-2-yl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[6-(thiophene-3-carbonylamino)-1H-benzimidazol-2-yl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 20695064 |
| Molecular Formula | C23H16N4O2S2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | N-[4-[6-(thiophene-3-carbonylamino)-1H-benzimidazol-2-yl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc2nc(-c3ccc(NC(=O)c4cccs4)cc3)[nH]c2c1)c1ccsc1 |
| InChI | InChI=1S/C23H16N4O2S2/c28-22(15-9-11-30-13-15)25-17-7-8-18-19(12-17)27-21(26-18)14-3-5-16(6-4-14)24-23(29)20-2-1-10-31-20/h1-13H,(H,24,29)(H,25,28)(H,26,27) |
| InChIKey | KEMHECQWHNVGFS-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |