C16H13N5O2S — CID 47067261
4-ethyl-N-[2-(furan-2-yl)-3H-benzimidazol-5-yl]thiadiazole-5-carboxamide (PubChem CID 47067261) has the molecular formula C16H13N5O2S and a molecular weight of 339.38 g/mol. Its IUPAC name is 4-ethyl-N-[2-(furan-2-yl)-3H-benzimidazol-5-yl]thiadiazole-5-carboxamide.
| Compound Name | 4-ethyl-N-[2-(furan-2-yl)-3H-benzimidazol-5-yl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 47067261 |
| Molecular Formula | C16H13N5O2S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 4-ethyl-N-[2-(furan-2-yl)-3H-benzimidazol-5-yl]thiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)Nc1ccc2nc(-c3ccco3)[nH]c2c1 |
| InChI | InChI=1S/C16H13N5O2S/c1-2-10-14(24-21-20-10)16(22)17-9-5-6-11-12(8-9)19-15(18-11)13-4-3-7-23-13/h3-8H,2H2,1H3,(H,17,22)(H,18,19) |
| InChIKey | JQZYRVNFRZMANM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |