C18H12FN3O2 — CID 57405664
N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]furan-2-carboxamide (PubChem CID 57405664) has the molecular formula C18H12FN3O2 and a molecular weight of 321.31 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]furan-2-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 57405664 |
| Molecular Formula | C18H12FN3O2 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc2nc(-c3ccc(F)cc3)[nH]c2c1)c1ccco1 |
| InChI | InChI=1S/C18H12FN3O2/c19-12-5-3-11(4-6-12)17-21-14-8-7-13(10-15(14)22-17)20-18(23)16-2-1-9-24-16/h1-10H,(H,20,23)(H,21,22) |
| InChIKey | RHAHTQDDCYKBLX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |