C22H15N3O2 — CID 1300314
N-[3-(1H-benzo[f]benzimidazol-2-yl)phenyl]furan-2-carboxamide (PubChem CID 1300314) has the molecular formula C22H15N3O2 and a molecular weight of 353.38 g/mol. Its IUPAC name is N-[3-(1H-benzo[f]benzimidazol-2-yl)phenyl]furan-2-carboxamide.
| Compound Name | N-[3-(1H-benzo[f]benzimidazol-2-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1300314 |
| Molecular Formula | C22H15N3O2 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-[3-(1H-benzo[f]benzimidazol-2-yl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(-c2nc3cc4ccccc4cc3[nH]2)c1)c1ccco1 |
| InChI | InChI=1S/C22H15N3O2/c26-22(20-9-4-10-27-20)23-17-8-3-7-16(11-17)21-24-18-12-14-5-1-2-6-15(14)13-19(18)25-21/h1-13H,(H,23,26)(H,24,25) |
| InChIKey | GEZWWOWOGKUIGG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |