C9H9NOS — CID 131010364
2-ethyl-1,3-benzoxazole-5-thiol (PubChem CID 131010364) has the molecular formula C9H9NOS and a molecular weight of 179.24 g/mol. Its IUPAC name is 2-ethyl-1,3-benzoxazole-5-thiol.
| Compound Name | 2-ethyl-1,3-benzoxazole-5-thiol |
|---|---|
| PubChem CID | 131010364 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 2-ethyl-1,3-benzoxazole-5-thiol |
| SMILES | CCc1nc2cc(S)ccc2o1 |
| InChI | InChI=1S/C9H9NOS/c1-2-9-10-7-5-6(12)3-4-8(7)11-9/h3-5,12H,2H2,1H3 |
| InChIKey | AXQNWZBYZHXQFR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|