C10H11NOS — CID 138604621
2-propan-2-yl-1,3-benzoxazole-5-thiol (PubChem CID 138604621) has the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. Its IUPAC name is 2-propan-2-yl-1,3-benzoxazole-5-thiol.
| Compound Name | 2-propan-2-yl-1,3-benzoxazole-5-thiol |
|---|---|
| PubChem CID | 138604621 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 2-propan-2-yl-1,3-benzoxazole-5-thiol |
| SMILES | CC(C)c1nc2cc(S)ccc2o1 |
| InChI | InChI=1S/C10H11NOS/c1-6(2)10-11-8-5-7(13)3-4-9(8)12-10/h3-6,13H,1-2H3 |
| InChIKey | GFACFPAXOZONLL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|