C17H26N2O — CID 43745098
N-heptyl-2-propan-2-yl-1,3-benzoxazol-5-amine (PubChem CID 43745098) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is N-heptyl-2-propan-2-yl-1,3-benzoxazol-5-amine.
| Compound Name | N-heptyl-2-propan-2-yl-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 43745098 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | N-heptyl-2-propan-2-yl-1,3-benzoxazol-5-amine |
| SMILES | CCCCCCCNc1ccc2oc(C(C)C)nc2c1 |
| InChI | InChI=1S/C17H26N2O/c1-4-5-6-7-8-11-18-14-9-10-16-15(12-14)19-17(20-16)13(2)3/h9-10,12-13,18H,4-8,11H2,1-3H3 |
| InChIKey | UMLOLWRBVAFNFH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|