C16H23N3O — CID 106633538
N-(piperidin-2-ylmethyl)-2-propan-2-yl-1,3-benzoxazol-5-amine (PubChem CID 106633538) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is N-(piperidin-2-ylmethyl)-2-propan-2-yl-1,3-benzoxazol-5-amine.
| Compound Name | N-(piperidin-2-ylmethyl)-2-propan-2-yl-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 106633538 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N-(piperidin-2-ylmethyl)-2-propan-2-yl-1,3-benzoxazol-5-amine |
| SMILES | CC(C)c1nc2cc(NCC3CCCCN3)ccc2o1 |
| InChI | InChI=1S/C16H23N3O/c1-11(2)16-19-14-9-12(6-7-15(14)20-16)18-10-13-5-3-4-8-17-13/h6-7,9,11,13,17-18H,3-5,8,10H2,1-2H3 |
| InChIKey | DVXJVONGSUAYKL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |