C15H22N2O — CID 63451586
2-ethyl-N-hexyl-1,3-benzoxazol-5-amine (PubChem CID 63451586) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-ethyl-N-hexyl-1,3-benzoxazol-5-amine.
| Compound Name | 2-ethyl-N-hexyl-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 63451586 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 2-ethyl-N-hexyl-1,3-benzoxazol-5-amine |
| SMILES | CCCCCCNc1ccc2oc(CC)nc2c1 |
| InChI | InChI=1S/C15H22N2O/c1-3-5-6-7-10-16-12-8-9-14-13(11-12)17-15(4-2)18-14/h8-9,11,16H,3-7,10H2,1-2H3 |
| InChIKey | GYQYCNSQZDPVPK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|