C14H20N2O2 — CID 65337571
3-[(2-ethyl-1,3-benzoxazol-5-yl)amino]-2-methylbutan-2-ol (PubChem CID 65337571) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 3-[(2-ethyl-1,3-benzoxazol-5-yl)amino]-2-methylbutan-2-ol.
| Compound Name | 3-[(2-ethyl-1,3-benzoxazol-5-yl)amino]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 65337571 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 3-[(2-ethyl-1,3-benzoxazol-5-yl)amino]-2-methylbutan-2-ol |
| SMILES | CCc1nc2cc(NC(C)C(C)(C)O)ccc2o1 |
| InChI | InChI=1S/C14H20N2O2/c1-5-13-16-11-8-10(6-7-12(11)18-13)15-9(2)14(3,4)17/h6-9,15,17H,5H2,1-4H3 |
| InChIKey | ZISIOKRXYSELOP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |