C15H21N3O2 — CID 60944281
2-amino-N-(2-ethyl-1,3-benzoxazol-5-yl)-3-methylpentanamide (PubChem CID 60944281) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-amino-N-(2-ethyl-1,3-benzoxazol-5-yl)-3-methylpentanamide.
| Compound Name | 2-amino-N-(2-ethyl-1,3-benzoxazol-5-yl)-3-methylpentanamide |
|---|---|
| PubChem CID | 60944281 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 2-amino-N-(2-ethyl-1,3-benzoxazol-5-yl)-3-methylpentanamide |
| SMILES | CCc1nc2cc(NC(=O)C(N)C(C)CC)ccc2o1 |
| InChI | InChI=1S/C15H21N3O2/c1-4-9(3)14(16)15(19)17-10-6-7-12-11(8-10)18-13(5-2)20-12/h6-9,14H,4-5,16H2,1-3H3,(H,17,19) |
| InChIKey | MIZVJHMYKNWNBB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |