C14H17N3O4 — CID 64888528
4-amino-5-[(2-ethyl-1,3-benzoxazol-5-yl)amino]-5-oxopentanoic acid (PubChem CID 64888528) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 4-amino-5-[(2-ethyl-1,3-benzoxazol-5-yl)amino]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[(2-ethyl-1,3-benzoxazol-5-yl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 64888528 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 4-amino-5-[(2-ethyl-1,3-benzoxazol-5-yl)amino]-5-oxopentanoic acid |
| SMILES | CCc1nc2cc(NC(=O)C(N)CCC(=O)O)ccc2o1 |
| InChI | InChI=1S/C14H17N3O4/c1-2-12-17-10-7-8(3-5-11(10)21-12)16-14(20)9(15)4-6-13(18)19/h3,5,7,9H,2,4,6,15H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | CJRWLGNSBKSTJJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |