C16H23N3O2 — CID 60946050
7-amino-N-(2-ethyl-1,3-benzoxazol-5-yl)heptanamide (PubChem CID 60946050) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 7-amino-N-(2-ethyl-1,3-benzoxazol-5-yl)heptanamide.
| Compound Name | 7-amino-N-(2-ethyl-1,3-benzoxazol-5-yl)heptanamide |
|---|---|
| PubChem CID | 60946050 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 7-amino-N-(2-ethyl-1,3-benzoxazol-5-yl)heptanamide |
| SMILES | CCc1nc2cc(NC(=O)CCCCCCN)ccc2o1 |
| InChI | InChI=1S/C16H23N3O2/c1-2-16-19-13-11-12(8-9-14(13)21-16)18-15(20)7-5-3-4-6-10-17/h8-9,11H,2-7,10,17H2,1H3,(H,18,20) |
| InChIKey | PNUWUJKJMKASQV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|