C21H24N2O4 — CID 60549765
4-(2-ethoxyphenoxy)-N-(2-ethyl-1,3-benzoxazol-5-yl)butanamide (PubChem CID 60549765) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 4-(2-ethoxyphenoxy)-N-(2-ethyl-1,3-benzoxazol-5-yl)butanamide.
| Compound Name | 4-(2-ethoxyphenoxy)-N-(2-ethyl-1,3-benzoxazol-5-yl)butanamide |
|---|---|
| PubChem CID | 60549765 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 4-(2-ethoxyphenoxy)-N-(2-ethyl-1,3-benzoxazol-5-yl)butanamide |
| SMILES | CCOc1ccccc1OCCCC(=O)Nc1ccc2oc(CC)nc2c1 |
| InChI | InChI=1S/C21H24N2O4/c1-3-21-23-16-14-15(11-12-17(16)27-21)22-20(24)10-7-13-26-19-9-6-5-8-18(19)25-4-2/h5-6,8-9,11-12,14H,3-4,7,10,13H2,1-2H3,(H,22,24) |
| InChIKey | IMYAMVKWDIPPAO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|