C18H20INO3 — CID 18229012
4-(2-ethoxyphenoxy)-N-(3-iodophenyl)butanamide (PubChem CID 18229012) has the molecular formula C18H20INO3 and a molecular weight of 425.27 g/mol. Its IUPAC name is 4-(2-ethoxyphenoxy)-N-(3-iodophenyl)butanamide.
| Compound Name | 4-(2-ethoxyphenoxy)-N-(3-iodophenyl)butanamide |
|---|---|
| PubChem CID | 18229012 |
| Molecular Formula | C18H20INO3 |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 4-(2-ethoxyphenoxy)-N-(3-iodophenyl)butanamide |
| SMILES | CCOc1ccccc1OCCCC(=O)Nc1cccc(I)c1 |
| InChI | InChI=1S/C18H20INO3/c1-2-22-16-9-3-4-10-17(16)23-12-6-11-18(21)20-15-8-5-7-14(19)13-15/h3-5,7-10,13H,2,6,11-12H2,1H3,(H,20,21) |
| InChIKey | NZGXRSJBUANNSN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|