C21H25FN2O4 — CID 7719430
4-(2-ethoxyphenoxy)-N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methylbutanamide (PubChem CID 7719430) has the molecular formula C21H25FN2O4 and a molecular weight of 388.44 g/mol. Its IUPAC name is 4-(2-ethoxyphenoxy)-N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methylbutanamide.
| Compound Name | 4-(2-ethoxyphenoxy)-N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 7719430 |
| Molecular Formula | C21H25FN2O4 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 4-(2-ethoxyphenoxy)-N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methylbutanamide |
| SMILES | CCOc1ccccc1OCCCC(=O)N(C)CC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C21H25FN2O4/c1-3-27-18-10-4-5-11-19(18)28-13-7-12-21(26)24(2)15-20(25)23-17-9-6-8-16(22)14-17/h4-6,8-11,14H,3,7,12-13,15H2,1-2H3,(H,23,25) |
| InChIKey | QYQFUSCJVJBGSV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|