C24H31N3O5 — CID 39757435
N-[4-[[2-(3,4-diethoxyanilino)-2-oxoethyl]-methylamino]-4-oxobutyl]benzamide (PubChem CID 39757435) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is N-[4-[[2-(3,4-diethoxyanilino)-2-oxoethyl]-methylamino]-4-oxobutyl]benzamide.
| Compound Name | N-[4-[[2-(3,4-diethoxyanilino)-2-oxoethyl]-methylamino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 39757435 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | N-[4-[[2-(3,4-diethoxyanilino)-2-oxoethyl]-methylamino]-4-oxobutyl]benzamide |
| SMILES | CCOc1ccc(NC(=O)CN(C)C(=O)CCCNC(=O)c2ccccc2)cc1OCC |
| InChI | InChI=1S/C24H31N3O5/c1-4-31-20-14-13-19(16-21(20)32-5-2)26-22(28)17-27(3)23(29)12-9-15-25-24(30)18-10-7-6-8-11-18/h6-8,10-11,13-14,16H,4-5,9,12,15,17H2,1-3H3,(H,25,30)(H,26,28) |
| InChIKey | SCMWRAIILIKQEY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|