C22H25Cl2N3O4 — CID 31183094
N-[4-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-4-oxobutyl]-2-ethoxybenzamide (PubChem CID 31183094) has the molecular formula C22H25Cl2N3O4 and a molecular weight of 466.37 g/mol. Its IUPAC name is N-[4-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-4-oxobutyl]-2-ethoxybenzamide.
| Compound Name | N-[4-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-4-oxobutyl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 31183094 |
| Molecular Formula | C22H25Cl2N3O4 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | N-[4-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-4-oxobutyl]-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)NCCCC(=O)N(C)CC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H25Cl2N3O4/c1-3-31-19-8-5-4-7-16(19)22(30)25-12-6-9-21(29)27(2)14-20(28)26-15-10-11-17(23)18(24)13-15/h4-5,7-8,10-11,13H,3,6,9,12,14H2,1-2H3,(H,25,30)(H,26,28) |
| InChIKey | DQXNTHPRGMZBTA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|