C23H29BrN2O5 — CID 24982397
4-(4-bromophenoxy)-N-[2-(3,4-diethoxyanilino)-2-oxoethyl]-N-methylbutanamide (PubChem CID 24982397) has the molecular formula C23H29BrN2O5 and a molecular weight of 493.40 g/mol. Its IUPAC name is 4-(4-bromophenoxy)-N-[2-(3,4-diethoxyanilino)-2-oxoethyl]-N-methylbutanamide.
| Compound Name | 4-(4-bromophenoxy)-N-[2-(3,4-diethoxyanilino)-2-oxoethyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 24982397 |
| Molecular Formula | C23H29BrN2O5 |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 4-(4-bromophenoxy)-N-[2-(3,4-diethoxyanilino)-2-oxoethyl]-N-methylbutanamide |
| SMILES | CCOc1ccc(NC(=O)CN(C)C(=O)CCCOc2ccc(Br)cc2)cc1OCC |
| InChI | InChI=1S/C23H29BrN2O5/c1-4-29-20-13-10-18(15-21(20)30-5-2)25-22(27)16-26(3)23(28)7-6-14-31-19-11-8-17(24)9-12-19/h8-13,15H,4-7,14,16H2,1-3H3,(H,25,27) |
| InChIKey | FJDWSLMXFVCCEB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|