C22H25BrN2O4 — CID 26904768
4-(4-acetylphenoxy)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-N-methylbutanamide (PubChem CID 26904768) has the molecular formula C22H25BrN2O4 and a molecular weight of 461.36 g/mol. Its IUPAC name is 4-(4-acetylphenoxy)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-N-methylbutanamide.
| Compound Name | 4-(4-acetylphenoxy)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 26904768 |
| Molecular Formula | C22H25BrN2O4 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 4-(4-acetylphenoxy)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-N-methylbutanamide |
| SMILES | CC(=O)c1ccc(OCCCC(=O)N(C)CC(=O)Nc2ccc(Br)cc2C)cc1 |
| InChI | InChI=1S/C22H25BrN2O4/c1-15-13-18(23)8-11-20(15)24-21(27)14-25(3)22(28)5-4-12-29-19-9-6-17(7-10-19)16(2)26/h6-11,13H,4-5,12,14H2,1-3H3,(H,24,27) |
| InChIKey | DUZBIHBRUCIVTM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|