C19H20BrClN2O2 — CID 36913449
N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(2-chlorophenyl)-N-methylpropanamide (PubChem CID 36913449) has the molecular formula C19H20BrClN2O2 and a molecular weight of 423.74 g/mol. Its IUPAC name is N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(2-chlorophenyl)-N-methylpropanamide.
| Compound Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(2-chlorophenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 36913449 |
| Molecular Formula | C19H20BrClN2O2 |
| Molecular Weight | 423.74 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(2-chlorophenyl)-N-methylpropanamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CN(C)C(=O)CCc1ccccc1Cl |
| InChI | InChI=1S/C19H20BrClN2O2/c1-13-11-15(20)8-9-17(13)22-18(24)12-23(2)19(25)10-7-14-5-3-4-6-16(14)21/h3-6,8-9,11H,7,10,12H2,1-2H3,(H,22,24) |
| InChIKey | RZDSJPSSFRORTN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.74 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |