C19H19Br2N3O3 — CID 27761796
2-bromo-N-[2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]benzamide (PubChem CID 27761796) has the molecular formula C19H19Br2N3O3 and a molecular weight of 497.19 g/mol. Its IUPAC name is 2-bromo-N-[2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]benzamide.
| Compound Name | 2-bromo-N-[2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 27761796 |
| Molecular Formula | C19H19Br2N3O3 |
| Molecular Weight | 497.19 g/mol |
| Exact Mass | 494.98 |
| IUPAC Name | 2-bromo-N-[2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]benzamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CN(C)C(=O)CNC(=O)c1ccccc1Br |
| InChI | InChI=1S/C19H19Br2N3O3/c1-12-9-13(20)7-8-16(12)23-17(25)11-24(2)18(26)10-22-19(27)14-5-3-4-6-15(14)21/h3-9H,10-11H2,1-2H3,(H,22,27)(H,23,25) |
| InChIKey | JMNCPTYVDOIJRB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.19 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |