C17H15Br2ClN2O2 — CID 26904812
5-bromo-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-2-chloro-N-methylbenzamide (PubChem CID 26904812) has the molecular formula C17H15Br2ClN2O2 and a molecular weight of 474.58 g/mol. Its IUPAC name is 5-bromo-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-2-chloro-N-methylbenzamide.
| Compound Name | 5-bromo-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-2-chloro-N-methylbenzamide |
|---|---|
| PubChem CID | 26904812 |
| Molecular Formula | C17H15Br2ClN2O2 |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 471.92 |
| IUPAC Name | 5-bromo-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-2-chloro-N-methylbenzamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CN(C)C(=O)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C17H15Br2ClN2O2/c1-10-7-11(18)4-6-15(10)21-16(23)9-22(2)17(24)13-8-12(19)3-5-14(13)20/h3-8H,9H2,1-2H3,(H,21,23) |
| InChIKey | OVBLWIQNHPHMCT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |