C16H14BrCl2N3O2 — CID 26904882
N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3,6-dichloro-N-methylpyridine-2-carboxamide (PubChem CID 26904882) has the molecular formula C16H14BrCl2N3O2 and a molecular weight of 431.12 g/mol. Its IUPAC name is N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3,6-dichloro-N-methylpyridine-2-carboxamide.
| Compound Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3,6-dichloro-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 26904882 |
| Molecular Formula | C16H14BrCl2N3O2 |
| Molecular Weight | 431.12 g/mol |
| Exact Mass | 428.96 |
| IUPAC Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3,6-dichloro-N-methylpyridine-2-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CN(C)C(=O)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H14BrCl2N3O2/c1-9-7-10(17)3-5-12(9)20-14(23)8-22(2)16(24)15-11(18)4-6-13(19)21-15/h3-7H,8H2,1-2H3,(H,20,23) |
| InChIKey | CRYYJGQUVNBUMZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.12 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|