C15H14BrClN2O2S — CID 26678374
N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-5-chloro-N-methylthiophene-2-carboxamide (PubChem CID 26678374) has the molecular formula C15H14BrClN2O2S and a molecular weight of 401.71 g/mol. Its IUPAC name is N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-5-chloro-N-methylthiophene-2-carboxamide.
| Compound Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-5-chloro-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 26678374 |
| Molecular Formula | C15H14BrClN2O2S |
| Molecular Weight | 401.71 g/mol |
| Exact Mass | 399.96 |
| IUPAC Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-5-chloro-N-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CN(C)C(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H14BrClN2O2S/c1-9-7-10(16)3-4-11(9)18-14(20)8-19(2)15(21)12-5-6-13(17)22-12/h3-7H,8H2,1-2H3,(H,18,20) |
| InChIKey | YRQFPEVNERWZHF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.71 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |