C17H18BrN3O3 — CID 134034240
N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-2-methoxy-N-methylpyridine-3-carboxamide (PubChem CID 134034240) has the molecular formula C17H18BrN3O3 and a molecular weight of 392.25 g/mol. Its IUPAC name is N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-2-methoxy-N-methylpyridine-3-carboxamide.
| Compound Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-2-methoxy-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 134034240 |
| Molecular Formula | C17H18BrN3O3 |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-2-methoxy-N-methylpyridine-3-carboxamide |
| SMILES | COc1ncccc1C(=O)N(C)CC(=O)Nc1ccc(Br)cc1C |
| InChI | InChI=1S/C17H18BrN3O3/c1-11-9-12(18)6-7-14(11)20-15(22)10-21(2)17(23)13-5-4-8-19-16(13)24-3/h4-9H,10H2,1-3H3,(H,20,22) |
| InChIKey | RWEIGNJOGLGPAR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |