C18H20BrN3O3 — CID 95771070
(2R)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-N-methyl-2-pyridin-3-yloxypropanamide (PubChem CID 95771070) has the molecular formula C18H20BrN3O3 and a molecular weight of 406.28 g/mol. Its IUPAC name is (2R)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-N-methyl-2-pyridin-3-yloxypropanamide.
| Compound Name | (2R)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-N-methyl-2-pyridin-3-yloxypropanamide |
|---|---|
| PubChem CID | 95771070 |
| Molecular Formula | C18H20BrN3O3 |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | (2R)-N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-N-methyl-2-pyridin-3-yloxypropanamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CN(C)C(=O)[C@@H](C)Oc1cccnc1 |
| InChI | InChI=1S/C18H20BrN3O3/c1-12-9-14(19)6-7-16(12)21-17(23)11-22(3)18(24)13(2)25-15-5-4-8-20-10-15/h4-10,13H,11H2,1-3H3,(H,21,23)/t13-/m1/s1 |
| InChIKey | ZAESLJTYYCNMCU-CYBMUJFWSA-N |
| XLogP | 3.02 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |