C13H16BrN3O — CID 9303278
N-(4-bromo-2-methylphenyl)-2-[[(1S)-1-cyanoethyl]-methylamino]acetamide (PubChem CID 9303278) has the molecular formula C13H16BrN3O and a molecular weight of 310.20 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2-[[(1S)-1-cyanoethyl]-methylamino]acetamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-2-[[(1S)-1-cyanoethyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 9303278 |
| Molecular Formula | C13H16BrN3O |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2-[[(1S)-1-cyanoethyl]-methylamino]acetamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CN(C)[C@@H](C)C#N |
| InChI | InChI=1S/C13H16BrN3O/c1-9-6-11(14)4-5-12(9)16-13(18)8-17(3)10(2)7-15/h4-6,10H,8H2,1-3H3,(H,16,18)/t10-/m0/s1 |
| InChIKey | SGMNUUYNNNVHNZ-JTQLQIEISA-N |
| XLogP | 2.54 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |