C23H22BrFN2O — CID 16609224
N-(4-bromo-2-methylphenyl)-2-[[(4-fluorophenyl)-phenylmethyl]-methylamino]acetamide (PubChem CID 16609224) has the molecular formula C23H22BrFN2O and a molecular weight of 441.34 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2-[[(4-fluorophenyl)-phenylmethyl]-methylamino]acetamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-2-[[(4-fluorophenyl)-phenylmethyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 16609224 |
| Molecular Formula | C23H22BrFN2O |
| Molecular Weight | 441.34 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2-[[(4-fluorophenyl)-phenylmethyl]-methylamino]acetamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CN(C)C(c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H22BrFN2O/c1-16-14-19(24)10-13-21(16)26-22(28)15-27(2)23(17-6-4-3-5-7-17)18-8-11-20(25)12-9-18/h3-14,23H,15H2,1-2H3,(H,26,28) |
| InChIKey | GSTHXMBPKGBQCD-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.34 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |