C15H21BrN4O3 — CID 51171679
2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]-methylamino]-N-(methylcarbamoyl)propanamide (PubChem CID 51171679) has the molecular formula C15H21BrN4O3 and a molecular weight of 385.26 g/mol. Its IUPAC name is 2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]-methylamino]-N-(methylcarbamoyl)propanamide.
| Compound Name | 2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]-methylamino]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 51171679 |
| Molecular Formula | C15H21BrN4O3 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]-methylamino]-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)C(C)N(C)CC(=O)Nc1ccc(Br)cc1C |
| InChI | InChI=1S/C15H21BrN4O3/c1-9-7-11(16)5-6-12(9)18-13(21)8-20(4)10(2)14(22)19-15(23)17-3/h5-7,10H,8H2,1-4H3,(H,18,21)(H2,17,19,22,23) |
| InChIKey | CPLXPSXWXLNPKN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |