C21H20BrN3O2 — CID 78871865
N-(4-bromo-2-methylphenyl)-2-[methyl(naphthalen-2-ylcarbamoyl)amino]acetamide (PubChem CID 78871865) has the molecular formula C21H20BrN3O2 and a molecular weight of 426.31 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2-[methyl(naphthalen-2-ylcarbamoyl)amino]acetamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-2-[methyl(naphthalen-2-ylcarbamoyl)amino]acetamide |
|---|---|
| PubChem CID | 78871865 |
| Molecular Formula | C21H20BrN3O2 |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2-[methyl(naphthalen-2-ylcarbamoyl)amino]acetamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CN(C)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H20BrN3O2/c1-14-11-17(22)8-10-19(14)24-20(26)13-25(2)21(27)23-18-9-7-15-5-3-4-6-16(15)12-18/h3-12H,13H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | UBHXDHXJVCFFMT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |