C22H27BrN2O4 — CID 27761676
N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-4-(2-ethoxyphenoxy)-N-methylbutanamide (PubChem CID 27761676) has the molecular formula C22H27BrN2O4 and a molecular weight of 463.37 g/mol. Its IUPAC name is N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-4-(2-ethoxyphenoxy)-N-methylbutanamide.
| Compound Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-4-(2-ethoxyphenoxy)-N-methylbutanamide |
|---|---|
| PubChem CID | 27761676 |
| Molecular Formula | C22H27BrN2O4 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-4-(2-ethoxyphenoxy)-N-methylbutanamide |
| SMILES | CCOc1ccccc1OCCCC(=O)N(C)CC(=O)Nc1ccc(Br)cc1C |
| InChI | InChI=1S/C22H27BrN2O4/c1-4-28-19-8-5-6-9-20(19)29-13-7-10-22(27)25(3)15-21(26)24-18-12-11-17(23)14-16(18)2/h5-6,8-9,11-12,14H,4,7,10,13,15H2,1-3H3,(H,24,26) |
| InChIKey | GNNACQPTIOSSBU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|