C21H22FN3O2 — CID 9439554
N-[2-(3-fluoroanilino)-2-oxoethyl]-4-(1H-indol-3-yl)-N-methylbutanamide (PubChem CID 9439554) has the molecular formula C21H22FN3O2 and a molecular weight of 367.42 g/mol. Its IUPAC name is N-[2-(3-fluoroanilino)-2-oxoethyl]-4-(1H-indol-3-yl)-N-methylbutanamide.
| Compound Name | N-[2-(3-fluoroanilino)-2-oxoethyl]-4-(1H-indol-3-yl)-N-methylbutanamide |
|---|---|
| PubChem CID | 9439554 |
| Molecular Formula | C21H22FN3O2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N-[2-(3-fluoroanilino)-2-oxoethyl]-4-(1H-indol-3-yl)-N-methylbutanamide |
| SMILES | CN(CC(=O)Nc1cccc(F)c1)C(=O)CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H22FN3O2/c1-25(14-20(26)24-17-8-5-7-16(22)12-17)21(27)11-4-6-15-13-23-19-10-3-2-9-18(15)19/h2-3,5,7-10,12-13,23H,4,6,11,14H2,1H3,(H,24,26) |
| InChIKey | WLEMESJKIBSUPC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |