C19H18F2N2O — CID 30707132
N-[(2,4-difluorophenyl)methyl]-3-(1H-indol-3-yl)-N-methylpropanamide (PubChem CID 30707132) has the molecular formula C19H18F2N2O and a molecular weight of 328.36 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-3-(1H-indol-3-yl)-N-methylpropanamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-3-(1H-indol-3-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 30707132 |
| Molecular Formula | C19H18F2N2O |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-3-(1H-indol-3-yl)-N-methylpropanamide |
| SMILES | CN(Cc1ccc(F)cc1F)C(=O)CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H18F2N2O/c1-23(12-14-6-8-15(20)10-17(14)21)19(24)9-7-13-11-22-18-5-3-2-4-16(13)18/h2-6,8,10-11,22H,7,9,12H2,1H3 |
| InChIKey | AYFPIMDRPQXBKY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |