C13H15F2NO3 — CID 54874892
5-[(2,4-difluorophenyl)methyl-methylamino]-5-oxopentanoic acid (PubChem CID 54874892) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is 5-[(2,4-difluorophenyl)methyl-methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[(2,4-difluorophenyl)methyl-methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 54874892 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 5-[(2,4-difluorophenyl)methyl-methylamino]-5-oxopentanoic acid |
| SMILES | CN(Cc1ccc(F)cc1F)C(=O)CCCC(=O)O |
| InChI | InChI=1S/C13H15F2NO3/c1-16(12(17)3-2-4-13(18)19)8-9-5-6-10(14)7-11(9)15/h5-7H,2-4,8H2,1H3,(H,18,19) |
| InChIKey | RSCVNARNVZRPRG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |