C13H17F2NO — CID 60725238
N-[(2,4-difluorophenyl)methyl]-N,2,2-trimethylpropanamide (PubChem CID 60725238) has the molecular formula C13H17F2NO and a molecular weight of 241.28 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-N,2,2-trimethylpropanamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 60725238 |
| Molecular Formula | C13H17F2NO |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-N,2,2-trimethylpropanamide |
| SMILES | CC(C)(C)C(=O)N(C)CC1=C(C=C(C=C1)F)F |
| InChI | InChI=1S/C13H17F2NO/c1-13(2,3)12(17)16(4)8-9-5-6-10(14)7-11(9)15/h5-7H,8H2,1-4H3 |
| InChIKey | UUWPTXYZAAKZOU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | 275 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |