About 2-hydroxyethyl N-[(2,4-difluorophenyl)methyl]-N-methylcarbamate
2-hydroxyethyl N-[(2,4-difluorophenyl)methyl]-N-methylcarbamate (PubChem CID 79345363) has the molecular formula C11H13F2NO3
and a molecular weight of 245.22 g/mol. Its IUPAC name is 2-hydroxyethyl N-[(2,4-difluorophenyl)methyl]-N-methylcarbamate.
Analyze 2-hydroxyethyl N-[(2,4-difluorophenyl)methyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl N-[(2,4-difluorophenyl)methyl]-N-methylcarbamate?
The IUPAC name of 2-hydroxyethyl N-[(2,4-difluorophenyl)methyl]-N-methylcarbamate (CID 79345363) is 2-hydroxyethyl N-[(2,4-difluorophenyl)methyl]-N-methylcarbamate.
What is the SMILES notation for 2-hydroxyethyl N-[(2,4-difluorophenyl)methyl]-N-methylcarbamate?
The canonical SMILES for 2-hydroxyethyl N-[(2,4-difluorophenyl)methyl]-N-methylcarbamate is CN(Cc1ccc(F)cc1F)C(=O)OCCO.
What is the InChIKey of 2-hydroxyethyl N-[(2,4-difluorophenyl)methyl]-N-methylcarbamate?
The InChIKey is QRVZASCEYWRAPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NO3/c1-14(11(16)17-5-4-15)7-8-2-3-9(12)6-10(8)13/h2-3,6,15H,4-5,7H2,1H3.
What are the key properties of 2-hydroxyethyl N-[(2,4-difluorophenyl)methyl]-N-methylcarbamate?
2-hydroxyethyl N-[(2,4-difluorophenyl)methyl]-N-methylcarbamate has a molecular weight of 245.22 g/mol, XLogP of 1.53, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl N-[(2,4-difluorophenyl)methyl]-N-methylcarbamate is sourced from PubChem (CID 79345363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).