C10H9F2NO2 — CID 115166392
N-[(2,4-difluorophenyl)methyl]-N-methyl-2-oxoacetamide (PubChem CID 115166392) has the molecular formula C10H9F2NO2 and a molecular weight of 213.18 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-N-methyl-2-oxoacetamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-N-methyl-2-oxoacetamide |
|---|---|
| PubChem CID | 115166392 |
| Molecular Formula | C10H9F2NO2 |
| Molecular Weight | 213.18 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-N-methyl-2-oxoacetamide |
| SMILES | CN(Cc1ccc(F)cc1F)C(=O)C=O |
| InChI | InChI=1S/C10H9F2NO2/c1-13(10(15)6-14)5-7-2-3-8(11)4-9(7)12/h2-4,6H,5H2,1H3 |
| InChIKey | VYXAWEIHOKFLPE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|