C9H9F2NO — CID 64990427
N-[(2,4-difluorophenyl)methyl]-N-methylformamide (PubChem CID 64990427) has the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-N-methylformamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-N-methylformamide |
|---|---|
| PubChem CID | 64990427 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-N-methylformamide |
| SMILES | CN(C=O)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C9H9F2NO/c1-12(6-13)5-7-2-3-8(10)4-9(7)11/h2-4,6H,5H2,1H3 |
| InChIKey | KOWCWZDDSMDHNR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|