C11H14F2N2 — CID 66188228
N-[(2,4-difluorophenyl)methyl]-N-methylazetidin-3-amine (PubChem CID 66188228) has the molecular formula C11H14F2N2 and a molecular weight of 212.24 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-N-methylazetidin-3-amine.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-N-methylazetidin-3-amine |
|---|---|
| PubChem CID | 66188228 |
| Molecular Formula | C11H14F2N2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-N-methylazetidin-3-amine |
| SMILES | CN(Cc1ccc(F)cc1F)C1CNC1 |
| InChI | InChI=1S/C11H14F2N2/c1-15(10-5-14-6-10)7-8-2-3-9(12)4-11(8)13/h2-4,10,14H,5-7H2,1H3 |
| InChIKey | MOXOPCNPYREYAP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |