C13H16F3NO — CID 121446878
N,2,2-trimethyl-N-[(2,3,5-trifluorophenyl)methyl]propanamide (PubChem CID 121446878) has the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. Its IUPAC name is N,2,2-trimethyl-N-[(2,3,5-trifluorophenyl)methyl]propanamide.
| Compound Name | N,2,2-trimethyl-N-[(2,3,5-trifluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 121446878 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N,2,2-trimethyl-N-[(2,3,5-trifluorophenyl)methyl]propanamide |
| SMILES | CN(Cc1cc(F)cc(F)c1F)C(=O)C(C)(C)C |
| InChI | InChI=1S/C13H16F3NO/c1-13(2,3)12(18)17(4)7-8-5-9(14)6-10(15)11(8)16/h5-6H,7H2,1-4H3 |
| InChIKey | UCVOTGOLWUYQTI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|