C21H25F6NO3 — CID 157217535
methane;N-methoxy-N-methyl-2-(2,3,5-trifluorophenyl)acetamide;1-(2,3,5-trifluorophenyl)propan-2-one (PubChem CID 157217535) has the molecular formula C21H25F6NO3 and a molecular weight of 453.42 g/mol. Its IUPAC name is methane;N-methoxy-N-methyl-2-(2,3,5-trifluorophenyl)acetamide;1-(2,3,5-trifluorophenyl)propan-2-one.
| Compound Name | methane;N-methoxy-N-methyl-2-(2,3,5-trifluorophenyl)acetamide;1-(2,3,5-trifluorophenyl)propan-2-one |
|---|---|
| PubChem CID | 157217535 |
| Molecular Formula | C21H25F6NO3 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | methane;N-methoxy-N-methyl-2-(2,3,5-trifluorophenyl)acetamide;1-(2,3,5-trifluorophenyl)propan-2-one |
| SMILES | C.C.CC(=O)Cc1cc(F)cc(F)c1F.CON(C)C(=O)Cc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C10H10F3NO2.C9H7F3O.2CH4/c1-14(16-2)9(15)4-6-3-7(11)5-8(12)10(6)13;1-5(13)2-6-3-7(10)4-8(11)9(6)12;;/h3,5H,4H2,1-2H3;3-4H,2H2,1H3;2*1H4 |
| InChIKey | ASPCPHSMDKYRMM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|